C19H24O5S — CID 10785003
[(5R,6S,8R)-2-oxo-8-prop-1-en-2-yl-1-oxaspiro[4.5]decan-6-yl] 4-methylbenzenesulfonate (PubChem CID 10785003) has the molecular formula C19H24O5S and a molecular weight of 364.46 g/mol. Its IUPAC name is [(5R,6S,8R)-2-oxo-8-prop-1-en-2-yl-1-oxaspiro[4.5]decan-6-yl] 4-methylbenzenesulfonate.
| Compound Name | [(5R,6S,8R)-2-oxo-8-prop-1-en-2-yl-1-oxaspiro[4.5]decan-6-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10785003 |
| Molecular Formula | C19H24O5S |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | [(5R,6S,8R)-2-oxo-8-prop-1-en-2-yl-1-oxaspiro[4.5]decan-6-yl] 4-methylbenzenesulfonate |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(CCC(=O)O2)[C@@H](OS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C19H24O5S/c1-13(2)15-8-10-19(11-9-18(20)23-19)17(12-15)24-25(21,22)16-6-4-14(3)5-7-16/h4-7,15,17H,1,8-12H2,2-3H3/t15-,17+,19-/m1/s1 |
| InChIKey | KXEPDLXTTJDCBS-HHXXYDBFSA-N |
| XLogP | 3.52 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|