C17H15N3 — CID 107850601
N-(2,3-dihydro-1H-inden-2-yl)quinazolin-2-amine (PubChem CID 107850601) has the molecular formula C17H15N3 and a molecular weight of 261.33 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)quinazolin-2-amine.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)quinazolin-2-amine |
|---|---|
| PubChem CID | 107850601 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)quinazolin-2-amine |
| SMILES | c1ccc2c(c1)CC(Nc1ncc3ccccc3n1)C2 |
| InChI | InChI=1S/C17H15N3/c1-2-6-13-10-15(9-12(13)5-1)19-17-18-11-14-7-3-4-8-16(14)20-17/h1-8,11,15H,9-10H2,(H,18,19,20) |
| InChIKey | GDTHWBMZCISXAS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |