About 3-(2,3-dihydro-1H-inden-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione
3-(2,3-dihydro-1H-inden-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 107850765) has the molecular formula C16H15N3S
and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione.
Molecular Properties
| Compound Name | 3-(2,3-dihydro-1H-inden-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione |
| PubChem CID | 107850765 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | Cc1ccnc2c1[nH]c(=S)n2C1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H15N3S/c1-10-6-7-17-15-14(10)18-16(20)19(15)13-8-11-4-2-3-5-12(11)9-13/h2-7,13H,8-9H2,1H3,(H,18,20) |
| InChIKey | WJRLQTDRCBXVBI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3-dihydro-1H-inden-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydro-1H-inden-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione?
The IUPAC name of 3-(2,3-dihydro-1H-inden-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione (CID 107850765) is 3-(2,3-dihydro-1H-inden-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione.
What is the SMILES notation for 3-(2,3-dihydro-1H-inden-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione?
The canonical SMILES for 3-(2,3-dihydro-1H-inden-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione is Cc1ccnc2c1[nH]c(=S)n2C1Cc2ccccc2C1.
What is the InChIKey of 3-(2,3-dihydro-1H-inden-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione?
The InChIKey is WJRLQTDRCBXVBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3S/c1-10-6-7-17-15-14(10)18-16(20)19(15)13-8-11-4-2-3-5-12(11)9-13/h2-7,13H,8-9H2,1H3,(H,18,20).
What are the key properties of 3-(2,3-dihydro-1H-inden-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione?
3-(2,3-dihydro-1H-inden-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione has a molecular weight of 281.38 g/mol, XLogP of 3.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1H-inden-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione is sourced from PubChem (CID 107850765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).