C14H14Br2N2 — CID 10785364
2-[(E)-1,2-dibromo-3,3-dimethylbut-1-enyl]quinoxaline (PubChem CID 10785364) has the molecular formula C14H14Br2N2 and a molecular weight of 370.09 g/mol. Its IUPAC name is 2-[(E)-1,2-dibromo-3,3-dimethylbut-1-enyl]quinoxaline.
| Compound Name | 2-[(E)-1,2-dibromo-3,3-dimethylbut-1-enyl]quinoxaline |
|---|---|
| PubChem CID | 10785364 |
| Molecular Formula | C14H14Br2N2 |
| Molecular Weight | 370.09 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | 2-[(E)-1,2-dibromo-3,3-dimethylbut-1-enyl]quinoxaline |
| SMILES | CC(C)(C)/C(Br)=C(\Br)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C14H14Br2N2/c1-14(2,3)13(16)12(15)11-8-17-9-6-4-5-7-10(9)18-11/h4-8H,1-3H3/b13-12+ |
| InChIKey | PIOLGZMAZQVOFB-OUKQBFOZSA-N |
| XLogP | 5.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.09 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |