C9H17NO5 — CID 107853982
4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-3-methylbut-2-enoic acid (PubChem CID 107853982) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-3-methylbut-2-enoic acid.
| Compound Name | 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 107853982 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-3-methylbut-2-enoic acid |
| SMILES | CC(=CC(=O)O)CNC(CO)(CO)CO |
| InChI | InChI=1S/C9H17NO5/c1-7(2-8(14)15)3-10-9(4-11,5-12)6-13/h2,10-13H,3-6H2,1H3,(H,14,15) |
| InChIKey | YXELSDKNGGDELC-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|