C22H17N3O3 — CID 10785446
(2S,6R,7R)-4-methyl-7-(4-methylphenyl)-3,5-dioxo-10-oxa-1,4-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-8,11,13,15-tetraene-8-carbonitrile (PubChem CID 10785446) has the molecular formula C22H17N3O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is (2S,6R,7R)-4-methyl-7-(4-methylphenyl)-3,5-dioxo-10-oxa-1,4-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-8,11,13,15-tetraene-8-carbonitrile.
| Compound Name | (2S,6R,7R)-4-methyl-7-(4-methylphenyl)-3,5-dioxo-10-oxa-1,4-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-8,11,13,15-tetraene-8-carbonitrile |
|---|---|
| PubChem CID | 10785446 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (2S,6R,7R)-4-methyl-7-(4-methylphenyl)-3,5-dioxo-10-oxa-1,4-diazatetracyclo[7.7.0.02,6.011,16]hexadeca-8,11,13,15-tetraene-8-carbonitrile |
| SMILES | Cc1ccc([C@@H]2C(C#N)=C3Oc4ccccc4N3[C@@H]3C(=O)N(C)C(=O)[C@@H]32)cc1 |
| InChI | InChI=1S/C22H17N3O3/c1-12-7-9-13(10-8-12)17-14(11-23)22-25(15-5-3-4-6-16(15)28-22)19-18(17)20(26)24(2)21(19)27/h3-10,17-19H,1-2H3/t17-,18-,19+/m1/s1 |
| InChIKey | GDBVYSYPNYNQEM-QRVBRYPASA-N |
| XLogP | 2.71 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|