About decyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate
decyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 10785471) has the molecular formula C24H37NO2
and a molecular weight of 371.57 g/mol. Its IUPAC name is decyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate.
Molecular Properties
| Compound Name | decyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
| PubChem CID | 10785471 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | decyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | CCCCCCCCCCOC(=O)C1=C(c2ccccc2)CCN(CC)C1 |
| InChI | InChI=1S/C24H37NO2/c1-3-5-6-7-8-9-10-14-19-27-24(26)23-20-25(4-2)18-17-22(23)21-15-12-11-13-16-21/h11-13,15-16H,3-10,14,17-20H2,1-2H3 |
| InChIKey | DPSJSZQSAMCEEQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate?
The IUPAC name of decyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate (CID 10785471) is decyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate.
What is the SMILES notation for decyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate?
The canonical SMILES for decyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate is CCCCCCCCCCOC(=O)C1=C(c2ccccc2)CCN(CC)C1.
What is the InChIKey of decyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate?
The InChIKey is DPSJSZQSAMCEEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H37NO2/c1-3-5-6-7-8-9-10-14-19-27-24(26)23-20-25(4-2)18-17-22(23)21-15-12-11-13-16-21/h11-13,15-16H,3-10,14,17-20H2,1-2H3.
What are the key properties of decyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate?
decyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate has a molecular weight of 371.57 g/mol, XLogP of 5.85, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for decyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate is sourced from PubChem (CID 10785471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).