C14H13IO4 — CID 10785482
5-(2-iodobenzoyl)-2,2,6-trimethyl-1,3-dioxin-4-one (PubChem CID 10785482) has the molecular formula C14H13IO4 and a molecular weight of 372.16 g/mol. Its IUPAC name is 5-(2-iodobenzoyl)-2,2,6-trimethyl-1,3-dioxin-4-one.
| Compound Name | 5-(2-iodobenzoyl)-2,2,6-trimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 10785482 |
| Molecular Formula | C14H13IO4 |
| Molecular Weight | 372.16 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 5-(2-iodobenzoyl)-2,2,6-trimethyl-1,3-dioxin-4-one |
| SMILES | CC1=C(C(=O)c2ccccc2I)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C14H13IO4/c1-8-11(13(17)19-14(2,3)18-8)12(16)9-6-4-5-7-10(9)15/h4-7H,1-3H3 |
| InChIKey | ILCMOLSWBVTCJZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.16 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|