About 2-[(6-hydrazinyl-2-pyridinyl)amino]-2-(hydroxymethyl)propane-1,3-diol
2-[(6-hydrazinyl-2-pyridinyl)amino]-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 107855145) has the molecular formula C9H16N4O3
and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-[(6-hydrazinyl-2-pyridinyl)amino]-2-(hydroxymethyl)propane-1,3-diol.
Molecular Properties
| Compound Name | 2-[(6-hydrazinyl-2-pyridinyl)amino]-2-(hydroxymethyl)propane-1,3-diol |
| PubChem CID | 107855145 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 2-[(6-hydrazinyl-2-pyridinyl)amino]-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | NNc1cccc(NC(CO)(CO)CO)n1 |
| InChI | InChI=1S/C9H16N4O3/c10-13-8-3-1-2-7(11-8)12-9(4-14,5-15)6-16/h1-3,14-16H,4-6,10H2,(H2,11,12,13) |
| InChIKey | NFCQXHLJMZRXPJ-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-hydrazinyl-2-pyridinyl)amino]-2-(hydroxymethyl)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-hydrazinyl-2-pyridinyl)amino]-2-(hydroxymethyl)propane-1,3-diol?
The IUPAC name of 2-[(6-hydrazinyl-2-pyridinyl)amino]-2-(hydroxymethyl)propane-1,3-diol (CID 107855145) is 2-[(6-hydrazinyl-2-pyridinyl)amino]-2-(hydroxymethyl)propane-1,3-diol.
What is the SMILES notation for 2-[(6-hydrazinyl-2-pyridinyl)amino]-2-(hydroxymethyl)propane-1,3-diol?
The canonical SMILES for 2-[(6-hydrazinyl-2-pyridinyl)amino]-2-(hydroxymethyl)propane-1,3-diol is NNc1cccc(NC(CO)(CO)CO)n1.
What is the InChIKey of 2-[(6-hydrazinyl-2-pyridinyl)amino]-2-(hydroxymethyl)propane-1,3-diol?
The InChIKey is NFCQXHLJMZRXPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O3/c10-13-8-3-1-2-7(11-8)12-9(4-14,5-15)6-16/h1-3,14-16H,4-6,10H2,(H2,11,12,13).
What are the key properties of 2-[(6-hydrazinyl-2-pyridinyl)amino]-2-(hydroxymethyl)propane-1,3-diol?
2-[(6-hydrazinyl-2-pyridinyl)amino]-2-(hydroxymethyl)propane-1,3-diol has a molecular weight of 228.25 g/mol, XLogP of -1.51, 6 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-hydrazinyl-2-pyridinyl)amino]-2-(hydroxymethyl)propane-1,3-diol is sourced from PubChem (CID 107855145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).