C19H21NO7 — CID 10785678
bis(prop-2-enyl) (2S)-2-[(4-formylphenoxy)carbonylamino]pentanedioate (PubChem CID 10785678) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is bis(prop-2-enyl) (2S)-2-[(4-formylphenoxy)carbonylamino]pentanedioate.
| Compound Name | bis(prop-2-enyl) (2S)-2-[(4-formylphenoxy)carbonylamino]pentanedioate |
|---|---|
| PubChem CID | 10785678 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | bis(prop-2-enyl) (2S)-2-[(4-formylphenoxy)carbonylamino]pentanedioate |
| SMILES | C=CCOC(=O)CC[C@H](NC(=O)Oc1ccc(C=O)cc1)C(=O)OCC=C |
| InChI | InChI=1S/C19H21NO7/c1-3-11-25-17(22)10-9-16(18(23)26-12-4-2)20-19(24)27-15-7-5-14(13-21)6-8-15/h3-8,13,16H,1-2,9-12H2,(H,20,24)/t16-/m0/s1 |
| InChIKey | UUBJWLPRIJQEMB-INIZCTEOSA-N |
| XLogP | 2.19 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|