C7H9N3O5S — CID 107858263
2-[(6-oxo-1H-pyridin-3-yl)sulfonylamino]oxyacetamide (PubChem CID 107858263) has the molecular formula C7H9N3O5S and a molecular weight of 247.23 g/mol. Its IUPAC name is 2-[(6-oxo-1H-pyridin-3-yl)sulfonylamino]oxyacetamide.
| Compound Name | 2-[(6-oxo-1H-pyridin-3-yl)sulfonylamino]oxyacetamide |
|---|---|
| PubChem CID | 107858263 |
| Molecular Formula | C7H9N3O5S |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 2-[(6-oxo-1H-pyridin-3-yl)sulfonylamino]oxyacetamide |
| SMILES | NC(=O)CONS(=O)(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C7H9N3O5S/c8-6(11)4-15-10-16(13,14)5-1-2-7(12)9-3-5/h1-3,10H,4H2,(H2,8,11)(H,9,12) |
| InChIKey | AYZKMRYCCXJCBQ-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 131.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|