C13H14N2O4S — CID 107858285
N-ethyl-N-(3-hydroxyphenyl)-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 107858285) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is N-ethyl-N-(3-hydroxyphenyl)-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | N-ethyl-N-(3-hydroxyphenyl)-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107858285 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | N-ethyl-N-(3-hydroxyphenyl)-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | CCN(c1cccc(O)c1)S(=O)(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C13H14N2O4S/c1-2-15(10-4-3-5-11(16)8-10)20(18,19)12-6-7-13(17)14-9-12/h3-9,16H,2H2,1H3,(H,14,17) |
| InChIKey | XKSJIXCTBRBKDQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |