C15H17ClN2O2S — CID 107858759
4-(2-chloroethyl)-N-[(1S)-1-pyridin-4-ylethyl]benzenesulfonamide (PubChem CID 107858759) has the molecular formula C15H17ClN2O2S and a molecular weight of 324.83 g/mol. Its IUPAC name is 4-(2-chloroethyl)-N-[(1S)-1-pyridin-4-ylethyl]benzenesulfonamide.
| Compound Name | 4-(2-chloroethyl)-N-[(1S)-1-pyridin-4-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 107858759 |
| Molecular Formula | C15H17ClN2O2S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4-(2-chloroethyl)-N-[(1S)-1-pyridin-4-ylethyl]benzenesulfonamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(CCCl)cc1)c1ccncc1 |
| InChI | InChI=1S/C15H17ClN2O2S/c1-12(14-7-10-17-11-8-14)18-21(19,20)15-4-2-13(3-5-15)6-9-16/h2-5,7-8,10-12,18H,6,9H2,1H3/t12-/m0/s1 |
| InChIKey | OPURGJKOVFJNHM-LBPRGKRZSA-N |
| XLogP | 2.90 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|