C17H18N2O8 — CID 10785880
dimethyl 9-hydroxy-4-methoxycarbonyloxy-3,7,8,9-tetrahydropyrrolo[3,2-f]quinoline-2,6-dicarboxylate (PubChem CID 10785880) has the molecular formula C17H18N2O8 and a molecular weight of 378.34 g/mol. Its IUPAC name is dimethyl 9-hydroxy-4-methoxycarbonyloxy-3,7,8,9-tetrahydropyrrolo[3,2-f]quinoline-2,6-dicarboxylate.
| Compound Name | dimethyl 9-hydroxy-4-methoxycarbonyloxy-3,7,8,9-tetrahydropyrrolo[3,2-f]quinoline-2,6-dicarboxylate |
|---|---|
| PubChem CID | 10785880 |
| Molecular Formula | C17H18N2O8 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | dimethyl 9-hydroxy-4-methoxycarbonyloxy-3,7,8,9-tetrahydropyrrolo[3,2-f]quinoline-2,6-dicarboxylate |
| SMILES | COC(=O)Oc1cc2c(c3cc(C(=O)OC)[nH]c13)C(O)CCN2C(=O)OC |
| InChI | InChI=1S/C17H18N2O8/c1-24-15(21)9-6-8-13-10(19(16(22)25-2)5-4-11(13)20)7-12(14(8)18-9)27-17(23)26-3/h6-7,11,18,20H,4-5H2,1-3H3 |
| InChIKey | XFXCBASLTFNDFI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|