C12H16Br2FN — CID 107859065
1-bromo-N-[(3-bromo-4-fluorophenyl)methyl]-3-methylbutan-2-amine (PubChem CID 107859065) has the molecular formula C12H16Br2FN and a molecular weight of 353.07 g/mol. Its IUPAC name is 1-bromo-N-[(3-bromo-4-fluorophenyl)methyl]-3-methylbutan-2-amine.
| Compound Name | 1-bromo-N-[(3-bromo-4-fluorophenyl)methyl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 107859065 |
| Molecular Formula | C12H16Br2FN |
| Molecular Weight | 353.07 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | 1-bromo-N-[(3-bromo-4-fluorophenyl)methyl]-3-methylbutan-2-amine |
| SMILES | CC(C)C(CBr)NCc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C12H16Br2FN/c1-8(2)12(6-13)16-7-9-3-4-11(15)10(14)5-9/h3-5,8,12,16H,6-7H2,1-2H3 |
| InChIKey | KBMAUSWIOXSWHY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.07 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|