C8H13BrN2S — CID 107859632
1-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propan-2-amine (PubChem CID 107859632) has the molecular formula C8H13BrN2S and a molecular weight of 249.18 g/mol. Its IUPAC name is 1-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propan-2-amine.
| Compound Name | 1-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 107859632 |
| Molecular Formula | C8H13BrN2S |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 1-bromo-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propan-2-amine |
| SMILES | Cc1csc(CNC(C)CBr)n1 |
| InChI | InChI=1S/C8H13BrN2S/c1-6(3-9)10-4-8-11-7(2)5-12-8/h5-6,10H,3-4H2,1-2H3 |
| InChIKey | RBRDYFKUOYWTMX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|