About 3,4,5-trihydroxypentanal
3,4,5-trihydroxypentanal (PubChem CID 10786) has the molecular formula C5H10O4
and a molecular weight of 134.13 g/mol. Its IUPAC name is 3,4,5-trihydroxypentanal.
Molecular Properties
| Compound Name | 3,4,5-trihydroxypentanal |
| PubChem CID | 10786 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 3,4,5-trihydroxypentanal |
| SMILES | O=CCC(O)C(O)CO |
| InChI | InChI=1S/C5H10O4/c6-2-1-4(8)5(9)3-7/h2,4-5,7-9H,1,3H2 |
| InChIKey | ASJSAQIRZKANQN-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,4,5-trihydroxypentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5-trihydroxypentanal?
The IUPAC name of 3,4,5-trihydroxypentanal (CID 10786) is 3,4,5-trihydroxypentanal.
What is the SMILES notation for 3,4,5-trihydroxypentanal?
The canonical SMILES for 3,4,5-trihydroxypentanal is O=CCC(O)C(O)CO.
What is the InChIKey of 3,4,5-trihydroxypentanal?
The InChIKey is ASJSAQIRZKANQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O4/c6-2-1-4(8)5(9)3-7/h2,4-5,7-9H,1,3H2.
What are the key properties of 3,4,5-trihydroxypentanal?
3,4,5-trihydroxypentanal has a molecular weight of 134.13 g/mol, XLogP of -1.71, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-trihydroxypentanal is sourced from PubChem (CID 10786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).