C12H20IN3O — CID 107860041
2-ethyl-N-(1-iodo-3-methylbutan-2-yl)-5-methylpyrazole-3-carboxamide (PubChem CID 107860041) has the molecular formula C12H20IN3O and a molecular weight of 349.22 g/mol. Its IUPAC name is 2-ethyl-N-(1-iodo-3-methylbutan-2-yl)-5-methylpyrazole-3-carboxamide.
| Compound Name | 2-ethyl-N-(1-iodo-3-methylbutan-2-yl)-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 107860041 |
| Molecular Formula | C12H20IN3O |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-ethyl-N-(1-iodo-3-methylbutan-2-yl)-5-methylpyrazole-3-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)NC(CI)C(C)C |
| InChI | InChI=1S/C12H20IN3O/c1-5-16-11(6-9(4)15-16)12(17)14-10(7-13)8(2)3/h6,8,10H,5,7H2,1-4H3,(H,14,17) |
| InChIKey | BNWMLIPQWGOYBG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|