C11H16INO2 — CID 107860051
N-(1-iodo-3-methylbutan-2-yl)-5-methylfuran-3-carboxamide (PubChem CID 107860051) has the molecular formula C11H16INO2 and a molecular weight of 321.16 g/mol. Its IUPAC name is N-(1-iodo-3-methylbutan-2-yl)-5-methylfuran-3-carboxamide.
| Compound Name | N-(1-iodo-3-methylbutan-2-yl)-5-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 107860051 |
| Molecular Formula | C11H16INO2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | N-(1-iodo-3-methylbutan-2-yl)-5-methylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC(CI)C(C)C)co1 |
| InChI | InChI=1S/C11H16INO2/c1-7(2)10(5-12)13-11(14)9-4-8(3)15-6-9/h4,6-7,10H,5H2,1-3H3,(H,13,14) |
| InChIKey | QNOFCHQJOJQTCN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|