C13H24N4O2 — CID 107860485
1-(3-aminopropyl)-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-5-methylpyrazole-4-carboxamide (PubChem CID 107860485) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-(3-aminopropyl)-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-(3-aminopropyl)-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 107860485 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 1-(3-aminopropyl)-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-5-methylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N[C@H](CO)C(C)C)cnn1CCCN |
| InChI | InChI=1S/C13H24N4O2/c1-9(2)12(8-18)16-13(19)11-7-15-17(10(11)3)6-4-5-14/h7,9,12,18H,4-6,8,14H2,1-3H3,(H,16,19)/t12-/m1/s1 |
| InChIKey | HRYTXWVWRRDGOH-GFCCVEGCSA-N |
| XLogP | 0.29 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |