C14H12ClF4N3O3 — CID 10786113
(2R)-2-[5-oxo-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,2,4-triazol-1-yl]propanoyl chloride (PubChem CID 10786113) has the molecular formula C14H12ClF4N3O3 and a molecular weight of 381.71 g/mol. Its IUPAC name is (2R)-2-[5-oxo-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,2,4-triazol-1-yl]propanoyl chloride.
| Compound Name | (2R)-2-[5-oxo-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,2,4-triazol-1-yl]propanoyl chloride |
|---|---|
| PubChem CID | 10786113 |
| Molecular Formula | C14H12ClF4N3O3 |
| Molecular Weight | 381.71 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | (2R)-2-[5-oxo-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1,2,4-triazol-1-yl]propanoyl chloride |
| SMILES | C[C@H](C(=O)Cl)n1ncn(-c2ccc(OCC(F)(F)C(F)F)cc2)c1=O |
| InChI | InChI=1S/C14H12ClF4N3O3/c1-8(11(15)23)22-13(24)21(7-20-22)9-2-4-10(5-3-9)25-6-14(18,19)12(16)17/h2-5,7-8,12H,6H2,1H3/t8-/m1/s1 |
| InChIKey | JPKRNEWSPTYQEW-MRVPVSSYSA-N |
| XLogP | 2.64 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.71 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|