C18H16F3NO3S — CID 10786190
[(6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl] trifluoromethanesulfonate (PubChem CID 10786190) has the molecular formula C18H16F3NO3S and a molecular weight of 383.39 g/mol. Its IUPAC name is [(6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl] trifluoromethanesulfonate.
| Compound Name | [(6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10786190 |
| Molecular Formula | C18H16F3NO3S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | [(6aR)-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl] trifluoromethanesulfonate |
| SMILES | CN1CCc2cccc3c2[C@H]1Cc1cccc(OS(=O)(=O)C(F)(F)F)c1-3 |
| InChI | InChI=1S/C18H16F3NO3S/c1-22-9-8-11-4-2-6-13-16(11)14(22)10-12-5-3-7-15(17(12)13)25-26(23,24)18(19,20)21/h2-7,14H,8-10H2,1H3/t14-/m1/s1 |
| InChIKey | AZFCGGUCEYWFCK-CQSZACIVSA-N |
| XLogP | 3.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|