C21H20O5S — CID 10786261
1-[(1R,4S,6R,9S)-5-(benzenesulfonyl)-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-dien-13-yl]ethanone (PubChem CID 10786261) has the molecular formula C21H20O5S and a molecular weight of 384.45 g/mol. Its IUPAC name is 1-[(1R,4S,6R,9S)-5-(benzenesulfonyl)-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-dien-13-yl]ethanone.
| Compound Name | 1-[(1R,4S,6R,9S)-5-(benzenesulfonyl)-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-dien-13-yl]ethanone |
|---|---|
| PubChem CID | 10786261 |
| Molecular Formula | C21H20O5S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 1-[(1R,4S,6R,9S)-5-(benzenesulfonyl)-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-dien-13-yl]ethanone |
| SMILES | CC(=O)C12C3(S(=O)(=O)c4ccccc4)[C@@H]4C=C[C@@]1(CCC[C@]21C=C[C@H]3O1)O4 |
| InChI | InChI=1S/C21H20O5S/c1-14(22)21-18-10-5-11-19(21)13-9-17(26-19)20(21,16(25-18)8-12-18)27(23,24)15-6-3-2-4-7-15/h2-4,6-9,12-13,16-17H,5,10-11H2,1H3/t16-,17+,18+,19-,20?,21? |
| InChIKey | UTMKREWIFOFQOD-LPWRKZRBSA-N |
| XLogP | 2.37 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|