C21H27NO6 — CID 10786566
(E)-N-[(3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-phenylprop-2-en-1-imine oxide (PubChem CID 10786566) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is (E)-N-[(3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-phenylprop-2-en-1-imine oxide.
| Compound Name | (E)-N-[(3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-phenylprop-2-en-1-imine oxide |
|---|---|
| PubChem CID | 10786566 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (E)-N-[(3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-phenylprop-2-en-1-imine oxide |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@@H](/[N+]([O-])=C/C=C/c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C21H27NO6/c1-20(2)24-13-15(26-20)17-16(18-19(25-17)28-21(3,4)27-18)22(23)12-8-11-14-9-6-5-7-10-14/h5-12,15-19H,13H2,1-4H3/b11-8+,22-12-/t15-,16-,17-,18-,19-/m1/s1 |
| InChIKey | YFWVBWYAASROLY-DKEXQSRJSA-N |
| XLogP | 2.68 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|