C12H18N2O5 — CID 107866172
2-ethyl-2-(3-methoxy-5-nitroanilino)propane-1,3-diol (PubChem CID 107866172) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-ethyl-2-(3-methoxy-5-nitroanilino)propane-1,3-diol.
| Compound Name | 2-ethyl-2-(3-methoxy-5-nitroanilino)propane-1,3-diol |
|---|---|
| PubChem CID | 107866172 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-ethyl-2-(3-methoxy-5-nitroanilino)propane-1,3-diol |
| SMILES | CCC(CO)(CO)Nc1cc(OC)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H18N2O5/c1-3-12(7-15,8-16)13-9-4-10(14(17)18)6-11(5-9)19-2/h4-6,13,15-16H,3,7-8H2,1-2H3 |
| InChIKey | HROXESVVOCOIBI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|