C15H20N2O3 — CID 107866247
2-ethyl-2-[(6-methoxyisoquinolin-1-yl)amino]propane-1,3-diol (PubChem CID 107866247) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-ethyl-2-[(6-methoxyisoquinolin-1-yl)amino]propane-1,3-diol.
| Compound Name | 2-ethyl-2-[(6-methoxyisoquinolin-1-yl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 107866247 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-ethyl-2-[(6-methoxyisoquinolin-1-yl)amino]propane-1,3-diol |
| SMILES | CCC(CO)(CO)Nc1nccc2cc(OC)ccc12 |
| InChI | InChI=1S/C15H20N2O3/c1-3-15(9-18,10-19)17-14-13-5-4-12(20-2)8-11(13)6-7-16-14/h4-8,18-19H,3,9-10H2,1-2H3,(H,16,17) |
| InChIKey | ZHYIQOMCEZUJQV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |