C13H23N3O3 — CID 107866306
3-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-1-(2-methylpropyl)pyrazin-2-one (PubChem CID 107866306) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-1-(2-methylpropyl)pyrazin-2-one.
| Compound Name | 3-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-1-(2-methylpropyl)pyrazin-2-one |
|---|---|
| PubChem CID | 107866306 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 3-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-1-(2-methylpropyl)pyrazin-2-one |
| SMILES | CCC(CO)(CO)Nc1nccn(CC(C)C)c1=O |
| InChI | InChI=1S/C13H23N3O3/c1-4-13(8-17,9-18)15-11-12(19)16(6-5-14-11)7-10(2)3/h5-6,10,17-18H,4,7-9H2,1-3H3,(H,14,15) |
| InChIKey | XACPYECKEUBGSI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |