C12H19NO5 — CID 107866396
5-[1-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]ethyl]furan-2-carboxylic acid (PubChem CID 107866396) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is 5-[1-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]ethyl]furan-2-carboxylic acid.
| Compound Name | 5-[1-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]ethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 107866396 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 5-[1-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]ethyl]furan-2-carboxylic acid |
| SMILES | CCC(CO)(CO)NC(C)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C12H19NO5/c1-3-12(6-14,7-15)13-8(2)9-4-5-10(18-9)11(16)17/h4-5,8,13-15H,3,6-7H2,1-2H3,(H,16,17) |
| InChIKey | OTXZFQRNVQTOQW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |