C13H18Cl2FNO — CID 107867108
1-chloro-2-(chloromethyl)-N-[(3-fluoro-4-methoxyphenyl)methyl]butan-2-amine (PubChem CID 107867108) has the molecular formula C13H18Cl2FNO and a molecular weight of 294.20 g/mol. Its IUPAC name is 1-chloro-2-(chloromethyl)-N-[(3-fluoro-4-methoxyphenyl)methyl]butan-2-amine.
| Compound Name | 1-chloro-2-(chloromethyl)-N-[(3-fluoro-4-methoxyphenyl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 107867108 |
| Molecular Formula | C13H18Cl2FNO |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 1-chloro-2-(chloromethyl)-N-[(3-fluoro-4-methoxyphenyl)methyl]butan-2-amine |
| SMILES | CCC(CCl)(CCl)NCc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C13H18Cl2FNO/c1-3-13(8-14,9-15)17-7-10-4-5-12(18-2)11(16)6-10/h4-6,17H,3,7-9H2,1-2H3 |
| InChIKey | LDGCSJHTZUXXDC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|