C20H31NO5Si — CID 10786762
1-O-benzyl 2-O-methyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate (PubChem CID 10786762) has the molecular formula C20H31NO5Si and a molecular weight of 393.56 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10786762 |
| Molecular Formula | C20H31NO5Si |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H31NO5Si/c1-20(2,3)27(5,6)26-16-12-17(18(22)24-4)21(13-16)19(23)25-14-15-10-8-7-9-11-15/h7-11,16-17H,12-14H2,1-6H3/t16-,17-/m0/s1 |
| InChIKey | CKCJCQFKYYPPQP-IRXDYDNUSA-N |
| XLogP | 3.96 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|