C12H19Br2N3O — CID 107868167
N-[1-bromo-2-(bromomethyl)butan-2-yl]-3-ethyl-1-methylpyrazole-5-carboxamide (PubChem CID 107868167) has the molecular formula C12H19Br2N3O and a molecular weight of 381.11 g/mol. Its IUPAC name is N-[1-bromo-2-(bromomethyl)butan-2-yl]-3-ethyl-1-methylpyrazole-5-carboxamide.
| Compound Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-3-ethyl-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 107868167 |
| Molecular Formula | C12H19Br2N3O |
| Molecular Weight | 381.11 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-3-ethyl-1-methylpyrazole-5-carboxamide |
| SMILES | CCc1cc(C(=O)NC(CC)(CBr)CBr)n(C)n1 |
| InChI | InChI=1S/C12H19Br2N3O/c1-4-9-6-10(17(3)16-9)11(18)15-12(5-2,7-13)8-14/h6H,4-5,7-8H2,1-3H3,(H,15,18) |
| InChIKey | JKZGZRQWSVFXFA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.11 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|