C13H17Br2NO4S — CID 107868265
N-[1-bromo-2-(bromomethyl)butan-2-yl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 107868265) has the molecular formula C13H17Br2NO4S and a molecular weight of 443.16 g/mol. Its IUPAC name is N-[1-bromo-2-(bromomethyl)butan-2-yl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 107868265 |
| Molecular Formula | C13H17Br2NO4S |
| Molecular Weight | 443.16 g/mol |
| Exact Mass | 440.92 |
| IUPAC Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | CCC(CBr)(CBr)NS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H17Br2NO4S/c1-2-13(8-14,9-15)16-21(17,18)10-3-4-11-12(7-10)20-6-5-19-11/h3-4,7,16H,2,5-6,8-9H2,1H3 |
| InChIKey | LTSIHEQWUMTKQV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.16 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|