About [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone
[1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone (PubChem CID 1078684) has the molecular formula C16H20Cl2N2O4S
and a molecular weight of 407.32 g/mol. Its IUPAC name is [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone |
| PubChem CID | 1078684 |
| Molecular Formula | C16H20Cl2N2O4S |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1)N1CCOCC1 |
| InChI | InChI=1S/C16H20Cl2N2O4S/c17-13-1-2-14(18)15(11-13)25(22,23)20-5-3-12(4-6-20)16(21)19-7-9-24-10-8-19/h1-2,11-12H,3-10H2 |
| InChIKey | BEPYVSCXBGHZQC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone?
The IUPAC name of [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone (CID 1078684) is [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone is O=C(C1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1)N1CCOCC1.
What is the InChIKey of [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone?
The InChIKey is BEPYVSCXBGHZQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20Cl2N2O4S/c17-13-1-2-14(18)15(11-13)25(22,23)20-5-3-12(4-6-20)16(21)19-7-9-24-10-8-19/h1-2,11-12H,3-10H2.
What are the key properties of [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone?
[1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone has a molecular weight of 407.32 g/mol, XLogP of 2.25, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,5-dichlorophenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 1078684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).