C26H40OSi — CID 10786952
[(Z)-7-but-3-enylhexadec-14-en-1,5,10-triyn-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10786952) has the molecular formula C26H40OSi and a molecular weight of 396.69 g/mol. Its IUPAC name is [(Z)-7-but-3-enylhexadec-14-en-1,5,10-triyn-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(Z)-7-but-3-enylhexadec-14-en-1,5,10-triyn-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10786952 |
| Molecular Formula | C26H40OSi |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | [(Z)-7-but-3-enylhexadec-14-en-1,5,10-triyn-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C#CCCC#CC(CCC#CCC/C=C\C)(CCC=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H40OSi/c1-9-12-15-17-18-19-21-24-26(22-14-11-3,23-20-16-13-10-2)27-28(7,8)25(4,5)6/h2,9,11-12H,3,13-17,21-22,24H2,1,4-8H3/b12-9- |
| InChIKey | AOZCJJXVKDASBS-XFXZXTDPSA-N |
| XLogP | 7.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|