C19H42N2 — CID 107869523
2-methyl-2-N,2-N-bis(3-methylbutyl)octane-1,2-diamine (PubChem CID 107869523) has the molecular formula C19H42N2 and a molecular weight of 298.56 g/mol. Its IUPAC name is 2-methyl-2-N,2-N-bis(3-methylbutyl)octane-1,2-diamine.
| Compound Name | 2-methyl-2-N,2-N-bis(3-methylbutyl)octane-1,2-diamine |
|---|---|
| PubChem CID | 107869523 |
| Molecular Formula | C19H42N2 |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.33 |
| IUPAC Name | 2-methyl-2-N,2-N-bis(3-methylbutyl)octane-1,2-diamine |
| SMILES | CCCCCCC(C)(CN)N(CCC(C)C)CCC(C)C |
| InChI | InChI=1S/C19H42N2/c1-7-8-9-10-13-19(6,16-20)21(14-11-17(2)3)15-12-18(4)5/h17-18H,7-16,20H2,1-6H3 |
| InChIKey | XNYZYCJLGQFLMD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|