C16H34N2O — CID 107869656
N',N'-bis(3-methylbutyl)-1-(oxolan-3-yl)ethane-1,2-diamine (PubChem CID 107869656) has the molecular formula C16H34N2O and a molecular weight of 270.46 g/mol. Its IUPAC name is N',N'-bis(3-methylbutyl)-1-(oxolan-3-yl)ethane-1,2-diamine.
| Compound Name | N',N'-bis(3-methylbutyl)-1-(oxolan-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 107869656 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | N',N'-bis(3-methylbutyl)-1-(oxolan-3-yl)ethane-1,2-diamine |
| SMILES | CC(C)CCN(CCC(C)C)CC(N)C1CCOC1 |
| InChI | InChI=1S/C16H34N2O/c1-13(2)5-8-18(9-6-14(3)4)11-16(17)15-7-10-19-12-15/h13-16H,5-12,17H2,1-4H3 |
| InChIKey | KJEPKBQDAJXDFK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |