About 6-[4-(1,3-dimethoxypropan-2-yl)piperazin-1-yl]benzo[b][1,4]benzothiazepine
6-[4-(1,3-dimethoxypropan-2-yl)piperazin-1-yl]benzo[b][1,4]benzothiazepine (PubChem CID 10787005) has the molecular formula C22H27N3O2S
and a molecular weight of 397.54 g/mol. Its IUPAC name is 6-[4-(1,3-dimethoxypropan-2-yl)piperazin-1-yl]benzo[b][1,4]benzothiazepine.
Molecular Properties
| Compound Name | 6-[4-(1,3-dimethoxypropan-2-yl)piperazin-1-yl]benzo[b][1,4]benzothiazepine |
| PubChem CID | 10787005 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 6-[4-(1,3-dimethoxypropan-2-yl)piperazin-1-yl]benzo[b][1,4]benzothiazepine |
| SMILES | COCC(COC)N1CCN(C2=Nc3ccccc3Sc3ccccc32)CC1 |
| InChI | InChI=1S/C22H27N3O2S/c1-26-15-17(16-27-2)24-11-13-25(14-12-24)22-18-7-3-5-9-20(18)28-21-10-6-4-8-19(21)23-22/h3-10,17H,11-16H2,1-2H3 |
| InChIKey | RRNTXALDXPBMJR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[4-(1,3-dimethoxypropan-2-yl)piperazin-1-yl]benzo[b][1,4]benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(1,3-dimethoxypropan-2-yl)piperazin-1-yl]benzo[b][1,4]benzothiazepine?
The IUPAC name of 6-[4-(1,3-dimethoxypropan-2-yl)piperazin-1-yl]benzo[b][1,4]benzothiazepine (CID 10787005) is 6-[4-(1,3-dimethoxypropan-2-yl)piperazin-1-yl]benzo[b][1,4]benzothiazepine.
What is the SMILES notation for 6-[4-(1,3-dimethoxypropan-2-yl)piperazin-1-yl]benzo[b][1,4]benzothiazepine?
The canonical SMILES for 6-[4-(1,3-dimethoxypropan-2-yl)piperazin-1-yl]benzo[b][1,4]benzothiazepine is COCC(COC)N1CCN(C2=Nc3ccccc3Sc3ccccc32)CC1.
What is the InChIKey of 6-[4-(1,3-dimethoxypropan-2-yl)piperazin-1-yl]benzo[b][1,4]benzothiazepine?
The InChIKey is RRNTXALDXPBMJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O2S/c1-26-15-17(16-27-2)24-11-13-25(14-12-24)22-18-7-3-5-9-20(18)28-21-10-6-4-8-19(21)23-22/h3-10,17H,11-16H2,1-2H3.
What are the key properties of 6-[4-(1,3-dimethoxypropan-2-yl)piperazin-1-yl]benzo[b][1,4]benzothiazepine?
6-[4-(1,3-dimethoxypropan-2-yl)piperazin-1-yl]benzo[b][1,4]benzothiazepine has a molecular weight of 397.54 g/mol, XLogP of 3.51, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(1,3-dimethoxypropan-2-yl)piperazin-1-yl]benzo[b][1,4]benzothiazepine is sourced from PubChem (CID 10787005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).