C15H25NO2S — CID 107870298
5-[bis(3-methylbutyl)amino]thiophene-2-carboxylic acid (PubChem CID 107870298) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is 5-[bis(3-methylbutyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 5-[bis(3-methylbutyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 107870298 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 5-[bis(3-methylbutyl)amino]thiophene-2-carboxylic acid |
| SMILES | CC(C)CCN(CCC(C)C)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C15H25NO2S/c1-11(2)7-9-16(10-8-12(3)4)14-6-5-13(19-14)15(17)18/h5-6,11-12H,7-10H2,1-4H3,(H,17,18) |
| InChIKey | NMLWKGMYUBZIGE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |