About 2-chloro-5-fluoro-N,N-bis(3-methylbutyl)pyrimidin-4-amine
2-chloro-5-fluoro-N,N-bis(3-methylbutyl)pyrimidin-4-amine (PubChem CID 107870649) has the molecular formula C14H23ClFN3
and a molecular weight of 287.81 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N,N-bis(3-methylbutyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-5-fluoro-N,N-bis(3-methylbutyl)pyrimidin-4-amine |
| PubChem CID | 107870649 |
| Molecular Formula | C14H23ClFN3 |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-chloro-5-fluoro-N,N-bis(3-methylbutyl)pyrimidin-4-amine |
| SMILES | CC(C)CCN(CCC(C)C)c1nc(Cl)ncc1F |
| InChI | InChI=1S/C14H23ClFN3/c1-10(2)5-7-19(8-6-11(3)4)13-12(16)9-17-14(15)18-13/h9-11H,5-8H2,1-4H3 |
| InChIKey | HSJDQOSDGUZHSG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-5-fluoro-N,N-bis(3-methylbutyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-fluoro-N,N-bis(3-methylbutyl)pyrimidin-4-amine?
The IUPAC name of 2-chloro-5-fluoro-N,N-bis(3-methylbutyl)pyrimidin-4-amine (CID 107870649) is 2-chloro-5-fluoro-N,N-bis(3-methylbutyl)pyrimidin-4-amine.
What is the SMILES notation for 2-chloro-5-fluoro-N,N-bis(3-methylbutyl)pyrimidin-4-amine?
The canonical SMILES for 2-chloro-5-fluoro-N,N-bis(3-methylbutyl)pyrimidin-4-amine is CC(C)CCN(CCC(C)C)c1nc(Cl)ncc1F.
What is the InChIKey of 2-chloro-5-fluoro-N,N-bis(3-methylbutyl)pyrimidin-4-amine?
The InChIKey is HSJDQOSDGUZHSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23ClFN3/c1-10(2)5-7-19(8-6-11(3)4)13-12(16)9-17-14(15)18-13/h9-11H,5-8H2,1-4H3.
What are the key properties of 2-chloro-5-fluoro-N,N-bis(3-methylbutyl)pyrimidin-4-amine?
2-chloro-5-fluoro-N,N-bis(3-methylbutyl)pyrimidin-4-amine has a molecular weight of 287.81 g/mol, XLogP of 4.17, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-fluoro-N,N-bis(3-methylbutyl)pyrimidin-4-amine is sourced from PubChem (CID 107870649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).