C16H28N2O — CID 107870750
[4-[bis(3-methylbutyl)amino]-2-pyridinyl]methanol (PubChem CID 107870750) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is [4-[bis(3-methylbutyl)amino]-2-pyridinyl]methanol.
| Compound Name | [4-[bis(3-methylbutyl)amino]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 107870750 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | [4-[bis(3-methylbutyl)amino]-2-pyridinyl]methanol |
| SMILES | CC(C)CCN(CCC(C)C)c1ccnc(CO)c1 |
| InChI | InChI=1S/C16H28N2O/c1-13(2)6-9-18(10-7-14(3)4)16-5-8-17-15(11-16)12-19/h5,8,11,13-14,19H,6-7,9-10,12H2,1-4H3 |
| InChIKey | JSUVILBIXNARFE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |