C20H31BrO3 — CID 10787085
(E)-6-bromo-1-[5-[1-(methoxymethoxy)prop-2-enyl]-2,6,6-trimethylcyclohexen-1-yl]hex-2-en-1-one (PubChem CID 10787085) has the molecular formula C20H31BrO3 and a molecular weight of 399.37 g/mol. Its IUPAC name is (E)-6-bromo-1-[5-[1-(methoxymethoxy)prop-2-enyl]-2,6,6-trimethylcyclohexen-1-yl]hex-2-en-1-one.
| Compound Name | (E)-6-bromo-1-[5-[1-(methoxymethoxy)prop-2-enyl]-2,6,6-trimethylcyclohexen-1-yl]hex-2-en-1-one |
|---|---|
| PubChem CID | 10787085 |
| Molecular Formula | C20H31BrO3 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (E)-6-bromo-1-[5-[1-(methoxymethoxy)prop-2-enyl]-2,6,6-trimethylcyclohexen-1-yl]hex-2-en-1-one |
| SMILES | C=CC(OCOC)C1CCC(C)=C(C(=O)/C=C/CCCBr)C1(C)C |
| InChI | InChI=1S/C20H31BrO3/c1-6-18(24-14-23-5)16-12-11-15(2)19(20(16,3)4)17(22)10-8-7-9-13-21/h6,8,10,16,18H,1,7,9,11-14H2,2-5H3/b10-8+ |
| InChIKey | QTYHQFUNYCPPED-CSKARUKUSA-N |
| XLogP | 5.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|