C17H35N3O — CID 107870991
1-amino-3-[bis(3-methylbutyl)amino]cyclohexane-1-carboxamide (PubChem CID 107870991) has the molecular formula C17H35N3O and a molecular weight of 297.49 g/mol. Its IUPAC name is 1-amino-3-[bis(3-methylbutyl)amino]cyclohexane-1-carboxamide.
| Compound Name | 1-amino-3-[bis(3-methylbutyl)amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 107870991 |
| Molecular Formula | C17H35N3O |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.28 |
| IUPAC Name | 1-amino-3-[bis(3-methylbutyl)amino]cyclohexane-1-carboxamide |
| SMILES | CC(C)CCN(CCC(C)C)C1CCCC(N)(C(N)=O)C1 |
| InChI | InChI=1S/C17H35N3O/c1-13(2)7-10-20(11-8-14(3)4)15-6-5-9-17(19,12-15)16(18)21/h13-15H,5-12,19H2,1-4H3,(H2,18,21) |
| InChIKey | FQWOQKBKUSZWHL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |