C18H22N6O4 — CID 1078713
3-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoic acid (PubChem CID 1078713) has the molecular formula C18H22N6O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is 3-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoic acid.
| Compound Name | 3-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 1078713 |
| Molecular Formula | C18H22N6O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 3-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoic acid |
| SMILES | O=C(O)c1cccc(Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C18H22N6O4/c25-15(26)13-2-1-3-14(12-13)19-16-20-17(23-4-8-27-9-5-23)22-18(21-16)24-6-10-28-11-7-24/h1-3,12H,4-11H2,(H,25,26)(H,19,20,21,22) |
| InChIKey | UKGNNYRCRGSVKA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |