C22H24O5S — CID 10787169
ethyl 4-(benzenesulfonyl)-3-cyclopropyl-2-(2-formylphenyl)butanoate (PubChem CID 10787169) has the molecular formula C22H24O5S and a molecular weight of 400.50 g/mol. Its IUPAC name is ethyl 4-(benzenesulfonyl)-3-cyclopropyl-2-(2-formylphenyl)butanoate.
| Compound Name | ethyl 4-(benzenesulfonyl)-3-cyclopropyl-2-(2-formylphenyl)butanoate |
|---|---|
| PubChem CID | 10787169 |
| Molecular Formula | C22H24O5S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | ethyl 4-(benzenesulfonyl)-3-cyclopropyl-2-(2-formylphenyl)butanoate |
| SMILES | CCOC(=O)C(c1ccccc1C=O)C(CS(=O)(=O)c1ccccc1)C1CC1 |
| InChI | InChI=1S/C22H24O5S/c1-2-27-22(24)21(19-11-7-6-8-17(19)14-23)20(16-12-13-16)15-28(25,26)18-9-4-3-5-10-18/h3-11,14,16,20-21H,2,12-13,15H2,1H3 |
| InChIKey | XFQZFOQHPWMNLH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|