About 5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine
5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine (PubChem CID 107871762) has the molecular formula C16H30N4
and a molecular weight of 278.44 g/mol. Its IUPAC name is 5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine |
| PubChem CID | 107871762 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine |
| SMILES | CCc1c(N)ncnc1N(CCC(C)C)CCC(C)C |
| InChI | InChI=1S/C16H30N4/c1-6-14-15(17)18-11-19-16(14)20(9-7-12(2)3)10-8-13(4)5/h11-13H,6-10H2,1-5H3,(H2,17,18,19) |
| InChIKey | SLKGWJPCULOKJU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine?
The IUPAC name of 5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine (CID 107871762) is 5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine.
What is the SMILES notation for 5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine?
The canonical SMILES for 5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine is CCc1c(N)ncnc1N(CCC(C)C)CCC(C)C.
What is the InChIKey of 5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine?
The InChIKey is SLKGWJPCULOKJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N4/c1-6-14-15(17)18-11-19-16(14)20(9-7-12(2)3)10-8-13(4)5/h11-13H,6-10H2,1-5H3,(H2,17,18,19).
What are the key properties of 5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine?
5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine has a molecular weight of 278.44 g/mol, XLogP of 3.52, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine is sourced from PubChem (CID 107871762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).