C16H30N4 — CID 107871762
5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine (PubChem CID 107871762) has the molecular formula C16H30N4 and a molecular weight of 278.44 g/mol. Its IUPAC name is 5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine.
| Compound Name | 5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 107871762 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 5-ethyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-4,6-diamine |
| SMILES | CCc1c(N)ncnc1N(CCC(C)C)CCC(C)C |
| InChI | InChI=1S/C16H30N4/c1-6-14-15(17)18-11-19-16(14)20(9-7-12(2)3)10-8-13(4)5/h11-13H,6-10H2,1-5H3,(H2,17,18,19) |
| InChIKey | SLKGWJPCULOKJU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |