About 6-hydrazinyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine
6-hydrazinyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine (PubChem CID 107871833) has the molecular formula C14H28N6
and a molecular weight of 280.42 g/mol. Its IUPAC name is 6-hydrazinyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-hydrazinyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine |
| PubChem CID | 107871833 |
| Molecular Formula | C14H28N6 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 6-hydrazinyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine |
| SMILES | CC(C)CCN(CCC(C)C)c1cc(NN)nc(N)n1 |
| InChI | InChI=1S/C14H28N6/c1-10(2)5-7-20(8-6-11(3)4)13-9-12(19-16)17-14(15)18-13/h9-11H,5-8,16H2,1-4H3,(H3,15,17,18,19) |
| InChIKey | PHPKXNIRKQPVCI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-hydrazinyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydrazinyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine?
The IUPAC name of 6-hydrazinyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine (CID 107871833) is 6-hydrazinyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 6-hydrazinyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine?
The canonical SMILES for 6-hydrazinyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine is CC(C)CCN(CCC(C)C)c1cc(NN)nc(N)n1.
What is the InChIKey of 6-hydrazinyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine?
The InChIKey is PHPKXNIRKQPVCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N6/c1-10(2)5-7-20(8-6-11(3)4)13-9-12(19-16)17-14(15)18-13/h9-11H,5-8,16H2,1-4H3,(H3,15,17,18,19).
What are the key properties of 6-hydrazinyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine?
6-hydrazinyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine has a molecular weight of 280.42 g/mol, XLogP of 2.24, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydrazinyl-4-N,4-N-bis(3-methylbutyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 107871833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).