About 5-bromo-2-hydrazinyl-N,N-bis(3-methylbutyl)pyrimidin-4-amine
5-bromo-2-hydrazinyl-N,N-bis(3-methylbutyl)pyrimidin-4-amine (PubChem CID 107871847) has the molecular formula C14H26BrN5
and a molecular weight of 344.30 g/mol. Its IUPAC name is 5-bromo-2-hydrazinyl-N,N-bis(3-methylbutyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-bromo-2-hydrazinyl-N,N-bis(3-methylbutyl)pyrimidin-4-amine |
| PubChem CID | 107871847 |
| Molecular Formula | C14H26BrN5 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 5-bromo-2-hydrazinyl-N,N-bis(3-methylbutyl)pyrimidin-4-amine |
| SMILES | CC(C)CCN(CCC(C)C)c1nc(NN)ncc1Br |
| InChI | InChI=1S/C14H26BrN5/c1-10(2)5-7-20(8-6-11(3)4)13-12(15)9-17-14(18-13)19-16/h9-11H,5-8,16H2,1-4H3,(H,17,18,19) |
| InChIKey | CZWIQMKHXUEVCS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-hydrazinyl-N,N-bis(3-methylbutyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-hydrazinyl-N,N-bis(3-methylbutyl)pyrimidin-4-amine?
The IUPAC name of 5-bromo-2-hydrazinyl-N,N-bis(3-methylbutyl)pyrimidin-4-amine (CID 107871847) is 5-bromo-2-hydrazinyl-N,N-bis(3-methylbutyl)pyrimidin-4-amine.
What is the SMILES notation for 5-bromo-2-hydrazinyl-N,N-bis(3-methylbutyl)pyrimidin-4-amine?
The canonical SMILES for 5-bromo-2-hydrazinyl-N,N-bis(3-methylbutyl)pyrimidin-4-amine is CC(C)CCN(CCC(C)C)c1nc(NN)ncc1Br.
What is the InChIKey of 5-bromo-2-hydrazinyl-N,N-bis(3-methylbutyl)pyrimidin-4-amine?
The InChIKey is CZWIQMKHXUEVCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26BrN5/c1-10(2)5-7-20(8-6-11(3)4)13-12(15)9-17-14(18-13)19-16/h9-11H,5-8,16H2,1-4H3,(H,17,18,19).
What are the key properties of 5-bromo-2-hydrazinyl-N,N-bis(3-methylbutyl)pyrimidin-4-amine?
5-bromo-2-hydrazinyl-N,N-bis(3-methylbutyl)pyrimidin-4-amine has a molecular weight of 344.30 g/mol, XLogP of 3.42, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-hydrazinyl-N,N-bis(3-methylbutyl)pyrimidin-4-amine is sourced from PubChem (CID 107871847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).