C14H13Br2N3O — CID 107872932
3-amino-5-bromo-N-(5-bromo-4-methyl-2-pyridinyl)-2-methylbenzamide (PubChem CID 107872932) has the molecular formula C14H13Br2N3O and a molecular weight of 399.09 g/mol. Its IUPAC name is 3-amino-5-bromo-N-(5-bromo-4-methyl-2-pyridinyl)-2-methylbenzamide.
| Compound Name | 3-amino-5-bromo-N-(5-bromo-4-methyl-2-pyridinyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 107872932 |
| Molecular Formula | C14H13Br2N3O |
| Molecular Weight | 399.09 g/mol |
| Exact Mass | 396.94 |
| IUPAC Name | 3-amino-5-bromo-N-(5-bromo-4-methyl-2-pyridinyl)-2-methylbenzamide |
| SMILES | Cc1cc(NC(=O)c2cc(Br)cc(N)c2C)ncc1Br |
| InChI | InChI=1S/C14H13Br2N3O/c1-7-3-13(18-6-11(7)16)19-14(20)10-4-9(15)5-12(17)8(10)2/h3-6H,17H2,1-2H3,(H,18,19,20) |
| InChIKey | CCEJMGPGFDIZPL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.09 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|