C23H17NO4S — CID 10787346
14-(2-hydroperoxy-3-methylbut-3-enyl)-3-thia-14-azapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,4,6,8,10,12(20),16,18-octaene-13,15-dione (PubChem CID 10787346) has the molecular formula C23H17NO4S and a molecular weight of 403.46 g/mol. Its IUPAC name is 14-(2-hydroperoxy-3-methylbut-3-enyl)-3-thia-14-azapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,4,6,8,10,12(20),16,18-octaene-13,15-dione.
| Compound Name | 14-(2-hydroperoxy-3-methylbut-3-enyl)-3-thia-14-azapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,4,6,8,10,12(20),16,18-octaene-13,15-dione |
|---|---|
| PubChem CID | 10787346 |
| Molecular Formula | C23H17NO4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 14-(2-hydroperoxy-3-methylbut-3-enyl)-3-thia-14-azapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,4,6,8,10,12(20),16,18-octaene-13,15-dione |
| SMILES | C=C(C)C(CN1C(=O)c2cccc3c2c(cc2c4ccccc4sc32)C1=O)OO |
| InChI | InChI=1S/C23H17NO4S/c1-12(2)18(28-27)11-24-22(25)15-8-5-7-14-20(15)17(23(24)26)10-16-13-6-3-4-9-19(13)29-21(14)16/h3-10,18,27H,1,11H2,2H3 |
| InChIKey | APGDUSYJAFPKJZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|