About 1-(2-bromo-4-propan-2-ylphenyl)-6-methyl-4-phenylpyrrolo[2,3-b]pyridine
1-(2-bromo-4-propan-2-ylphenyl)-6-methyl-4-phenylpyrrolo[2,3-b]pyridine (PubChem CID 10787443) has the molecular formula C23H21BrN2
and a molecular weight of 405.34 g/mol. Its IUPAC name is 1-(2-bromo-4-propan-2-ylphenyl)-6-methyl-4-phenylpyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 1-(2-bromo-4-propan-2-ylphenyl)-6-methyl-4-phenylpyrrolo[2,3-b]pyridine |
| PubChem CID | 10787443 |
| Molecular Formula | C23H21BrN2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-(2-bromo-4-propan-2-ylphenyl)-6-methyl-4-phenylpyrrolo[2,3-b]pyridine |
| SMILES | Cc1cc(-c2ccccc2)c2ccn(-c3ccc(C(C)C)cc3Br)c2n1 |
| InChI | InChI=1S/C23H21BrN2/c1-15(2)18-9-10-22(21(24)14-18)26-12-11-19-20(13-16(3)25-23(19)26)17-7-5-4-6-8-17/h4-15H,1-3H3 |
| InChIKey | NIQBQCGMLBLOAL-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-bromo-4-propan-2-ylphenyl)-6-methyl-4-phenylpyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromo-4-propan-2-ylphenyl)-6-methyl-4-phenylpyrrolo[2,3-b]pyridine?
The IUPAC name of 1-(2-bromo-4-propan-2-ylphenyl)-6-methyl-4-phenylpyrrolo[2,3-b]pyridine (CID 10787443) is 1-(2-bromo-4-propan-2-ylphenyl)-6-methyl-4-phenylpyrrolo[2,3-b]pyridine.
What is the SMILES notation for 1-(2-bromo-4-propan-2-ylphenyl)-6-methyl-4-phenylpyrrolo[2,3-b]pyridine?
The canonical SMILES for 1-(2-bromo-4-propan-2-ylphenyl)-6-methyl-4-phenylpyrrolo[2,3-b]pyridine is Cc1cc(-c2ccccc2)c2ccn(-c3ccc(C(C)C)cc3Br)c2n1.
What is the InChIKey of 1-(2-bromo-4-propan-2-ylphenyl)-6-methyl-4-phenylpyrrolo[2,3-b]pyridine?
The InChIKey is NIQBQCGMLBLOAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21BrN2/c1-15(2)18-9-10-22(21(24)14-18)26-12-11-19-20(13-16(3)25-23(19)26)17-7-5-4-6-8-17/h4-15H,1-3H3.
What are the key properties of 1-(2-bromo-4-propan-2-ylphenyl)-6-methyl-4-phenylpyrrolo[2,3-b]pyridine?
1-(2-bromo-4-propan-2-ylphenyl)-6-methyl-4-phenylpyrrolo[2,3-b]pyridine has a molecular weight of 405.34 g/mol, XLogP of 6.89, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromo-4-propan-2-ylphenyl)-6-methyl-4-phenylpyrrolo[2,3-b]pyridine is sourced from PubChem (CID 10787443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).